C22H31N3O6 — CID 138731089
benzyl N-[1-[(5,6-dioxo-1,4-oxazecan-7-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 138731089) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is benzyl N-[1-[(5,6-dioxo-1,4-oxazecan-7-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(5,6-dioxo-1,4-oxazecan-7-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138731089 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | benzyl N-[1-[(5,6-dioxo-1,4-oxazecan-7-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC1CCCOCCNC(=O)C1=O |
| InChI | InChI=1S/C22H31N3O6/c1-15(2)13-18(25-22(29)31-14-16-7-4-3-5-8-16)20(27)24-17-9-6-11-30-12-10-23-21(28)19(17)26/h3-5,7-8,15,17-18H,6,9-14H2,1-2H3,(H,23,28)(H,24,27)(H,25,29) |
| InChIKey | AJSMCFPVYORZKJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|