C20H27N3O7 — CID 138730080
benzyl N-[1-[(3,4-dioxo-1,8,2-dioxazecan-5-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138730080) has the molecular formula C20H27N3O7 and a molecular weight of 421.45 g/mol. Its IUPAC name is benzyl N-[1-[(3,4-dioxo-1,8,2-dioxazecan-5-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(3,4-dioxo-1,8,2-dioxazecan-5-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730080 |
| Molecular Formula | C20H27N3O7 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | benzyl N-[1-[(3,4-dioxo-1,8,2-dioxazecan-5-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC1CCOCCONC(=O)C1=O |
| InChI | InChI=1S/C20H27N3O7/c1-13(2)16(22-20(27)29-12-14-6-4-3-5-7-14)18(25)21-15-8-9-28-10-11-30-23-19(26)17(15)24/h3-7,13,15-16H,8-12H2,1-2H3,(H,21,25)(H,22,27)(H,23,26) |
| InChIKey | ANKDYQKUPCIALE-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|