C22H25N5O5 — CID 138730723
benzyl N-[1-[(4,5-dioxo-3,9,11-triazabicyclo[6.3.1]dodeca-1(11),8(12),9-trien-6-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138730723) has the molecular formula C22H25N5O5 and a molecular weight of 439.47 g/mol. Its IUPAC name is benzyl N-[1-[(4,5-dioxo-3,9,11-triazabicyclo[6.3.1]dodeca-1(11),8(12),9-trien-6-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(4,5-dioxo-3,9,11-triazabicyclo[6.3.1]dodeca-1(11),8(12),9-trien-6-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730723 |
| Molecular Formula | C22H25N5O5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | benzyl N-[1-[(4,5-dioxo-3,9,11-triazabicyclo[6.3.1]dodeca-1(11),8(12),9-trien-6-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC1Cc2cc(ncn2)CNC(=O)C1=O |
| InChI | InChI=1S/C22H25N5O5/c1-13(2)18(27-22(31)32-11-14-6-4-3-5-7-14)20(29)26-17-9-15-8-16(25-12-24-15)10-23-21(30)19(17)28/h3-8,12-13,17-18H,9-11H2,1-2H3,(H,23,30)(H,26,29)(H,27,31) |
| InChIKey | VRWMUJOXWYEOPW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 139.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|