C21H26N6O5 — CID 138731088
benzyl N-[1-[(5,6-dioxo-1,4,10,11-tetrazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138731088) has the molecular formula C21H26N6O5 and a molecular weight of 442.48 g/mol. Its IUPAC name is benzyl N-[1-[(5,6-dioxo-1,4,10,11-tetrazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(5,6-dioxo-1,4,10,11-tetrazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138731088 |
| Molecular Formula | C21H26N6O5 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | benzyl N-[1-[(5,6-dioxo-1,4,10,11-tetrazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC1Cc2cn(nn2)CCNC(=O)C1=O |
| InChI | InChI=1S/C21H26N6O5/c1-13(2)17(24-21(31)32-12-14-6-4-3-5-7-14)19(29)23-16-10-15-11-27(26-25-15)9-8-22-20(30)18(16)28/h3-7,11,13,16-17H,8-10,12H2,1-2H3,(H,22,30)(H,23,29)(H,24,31) |
| InChIKey | INUYWSHJVHVYJF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|