C28H38N6O6 — CID 138731531
benzyl N-[1-[[1-[(5,6-dioxo-1,4,10-triazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138731531) has the molecular formula C28H38N6O6 and a molecular weight of 554.65 g/mol. Its IUPAC name is benzyl N-[1-[[1-[(5,6-dioxo-1,4,10-triazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[1-[(5,6-dioxo-1,4,10-triazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138731531 |
| Molecular Formula | C28H38N6O6 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | benzyl N-[1-[[1-[(5,6-dioxo-1,4,10-triazabicyclo[7.2.1]dodeca-9(12),10-dien-7-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)OCc1ccccc1)C(C)C)C(=O)NC1Cc2cn(cn2)CCNC(=O)C1=O |
| InChI | InChI=1S/C28H38N6O6/c1-17(2)12-22(25(36)31-21-13-20-14-34(16-30-20)11-10-29-27(38)24(21)35)32-26(37)23(18(3)4)33-28(39)40-15-19-8-6-5-7-9-19/h5-9,14,16-18,21-23H,10-13,15H2,1-4H3,(H,29,38)(H,31,36)(H,32,37)(H,33,39) |
| InChIKey | SVQPDQSQGNPJIO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 160.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|