C23H33N3O6 — CID 138731228
benzyl N-[1-[(4,5-dioxo-1-oxa-6-azacyclododec-3-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138731228) has the molecular formula C23H33N3O6 and a molecular weight of 447.53 g/mol. Its IUPAC name is benzyl N-[1-[(4,5-dioxo-1-oxa-6-azacyclododec-3-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(4,5-dioxo-1-oxa-6-azacyclododec-3-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138731228 |
| Molecular Formula | C23H33N3O6 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | benzyl N-[1-[(4,5-dioxo-1-oxa-6-azacyclododec-3-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC1COCCCCCCNC(=O)C1=O |
| InChI | InChI=1S/C23H33N3O6/c1-16(2)19(26-23(30)32-14-17-10-6-5-7-11-17)21(28)25-18-15-31-13-9-4-3-8-12-24-22(29)20(18)27/h5-7,10-11,16,18-19H,3-4,8-9,12-15H2,1-2H3,(H,24,29)(H,25,28)(H,26,30) |
| InChIKey | AUUILLAJRHXEGS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|