C17H29N3O6 — CID 138730489
2,2-dimethylpropyl N-[1-[(5,6-dioxo-1,4-oxazocan-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138730489) has the molecular formula C17H29N3O6 and a molecular weight of 371.43 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[1-[(5,6-dioxo-1,4-oxazocan-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | 2,2-dimethylpropyl N-[1-[(5,6-dioxo-1,4-oxazocan-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730489 |
| Molecular Formula | C17H29N3O6 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 2,2-dimethylpropyl N-[1-[(5,6-dioxo-1,4-oxazocan-7-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCC(C)(C)C)C(=O)NC1COCCNC(=O)C1=O |
| InChI | InChI=1S/C17H29N3O6/c1-10(2)12(20-16(24)26-9-17(3,4)5)14(22)19-11-8-25-7-6-18-15(23)13(11)21/h10-12H,6-9H2,1-5H3,(H,18,23)(H,19,22)(H,20,24) |
| InChIKey | NIVYFEANWKPDOX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|