C21H37N3O6 — CID 138730799
2,2-dimethylpropyl N-[1-[(7,8-dioxo-1-oxa-6-azacyclododec-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 138730799) has the molecular formula C21H37N3O6 and a molecular weight of 427.54 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[1-[(7,8-dioxo-1-oxa-6-azacyclododec-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | 2,2-dimethylpropyl N-[1-[(7,8-dioxo-1-oxa-6-azacyclododec-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730799 |
| Molecular Formula | C21H37N3O6 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 2,2-dimethylpropyl N-[1-[(7,8-dioxo-1-oxa-6-azacyclododec-9-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCC(C)(C)C)C(=O)NC1CCCOCCCCNC(=O)C1=O |
| InChI | InChI=1S/C21H37N3O6/c1-14(2)16(24-20(28)30-13-21(3,4)5)18(26)23-15-9-8-12-29-11-7-6-10-22-19(27)17(15)25/h14-16H,6-13H2,1-5H3,(H,22,27)(H,23,26)(H,24,28) |
| InChIKey | BKHQLKBDJRNIOF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|