C15H26N4O5 — CID 138730226
2,2-dimethylpropyl N-[3-amino-1-[(2,3-dioxopiperidin-4-yl)amino]-1-oxobutan-2-yl]carbamate (PubChem CID 138730226) has the molecular formula C15H26N4O5 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2,2-dimethylpropyl N-[3-amino-1-[(2,3-dioxopiperidin-4-yl)amino]-1-oxobutan-2-yl]carbamate.
| Compound Name | 2,2-dimethylpropyl N-[3-amino-1-[(2,3-dioxopiperidin-4-yl)amino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730226 |
| Molecular Formula | C15H26N4O5 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2,2-dimethylpropyl N-[3-amino-1-[(2,3-dioxopiperidin-4-yl)amino]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(N)C(NC(=O)OCC(C)(C)C)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C15H26N4O5/c1-8(16)10(19-14(23)24-7-15(2,3)4)12(21)18-9-5-6-17-13(22)11(9)20/h8-10H,5-7,16H2,1-4H3,(H,17,22)(H,18,21)(H,19,23) |
| InChIKey | JIWLVIOYBNTKGB-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|