C25H42N2O6 — CID 158111412
2,2-dimethylpropyl 3-[[1-(2,3-dioxopiperidin-4-yl)-5-methyl-2-oxohexan-3-yl]carbamoyl]-5-methylhexanoate (PubChem CID 158111412) has the molecular formula C25H42N2O6 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2,2-dimethylpropyl 3-[[1-(2,3-dioxopiperidin-4-yl)-5-methyl-2-oxohexan-3-yl]carbamoyl]-5-methylhexanoate.
| Compound Name | 2,2-dimethylpropyl 3-[[1-(2,3-dioxopiperidin-4-yl)-5-methyl-2-oxohexan-3-yl]carbamoyl]-5-methylhexanoate |
|---|---|
| PubChem CID | 158111412 |
| Molecular Formula | C25H42N2O6 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.30 |
| IUPAC Name | 2,2-dimethylpropyl 3-[[1-(2,3-dioxopiperidin-4-yl)-5-methyl-2-oxohexan-3-yl]carbamoyl]-5-methylhexanoate |
| SMILES | CC(C)CC(CC(=O)OCC(C)(C)C)C(=O)NC(CC(C)C)C(=O)CC1CCNC(=O)C1=O |
| InChI | InChI=1S/C25H42N2O6/c1-15(2)10-18(13-21(29)33-14-25(5,6)7)23(31)27-19(11-16(3)4)20(28)12-17-8-9-26-24(32)22(17)30/h15-19H,8-14H2,1-7H3,(H,26,32)(H,27,31) |
| InChIKey | FQMCTFZQCWOJRV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|