C17H28N2O5 — CID 149084260
(2-amino-2-methylpropyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanoate (PubChem CID 149084260) has the molecular formula C17H28N2O5 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2-amino-2-methylpropyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanoate.
| Compound Name | (2-amino-2-methylpropyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 149084260 |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2-amino-2-methylpropyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanoate |
| SMILES | CC(C)C(CC(=O)OCC(C)(C)N)C(=O)CC1CCNC(=O)C1=O |
| InChI | InChI=1S/C17H28N2O5/c1-10(2)12(8-14(21)24-9-17(3,4)18)13(20)7-11-5-6-19-16(23)15(11)22/h10-12H,5-9,18H2,1-4H3,(H,19,23) |
| InChIKey | QQYBEHVRTWRXGL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|