C18H24N2O6 — CID 159358466
2-(furan-2-yl)ethyl N-[1-(2,3-dioxopiperidin-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate (PubChem CID 159358466) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-(furan-2-yl)ethyl N-[1-(2,3-dioxopiperidin-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate.
| Compound Name | 2-(furan-2-yl)ethyl N-[1-(2,3-dioxopiperidin-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
|---|---|
| PubChem CID | 159358466 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(furan-2-yl)ethyl N-[1-(2,3-dioxopiperidin-4-yl)-4-methyl-2-oxopentan-3-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OCCc1ccco1)C(=O)CC1CCNC(=O)C1=O |
| InChI | InChI=1S/C18H24N2O6/c1-11(2)15(14(21)10-12-5-7-19-17(23)16(12)22)20-18(24)26-9-6-13-4-3-8-25-13/h3-4,8,11-12,15H,5-7,9-10H2,1-2H3,(H,19,23)(H,20,24) |
| InChIKey | LIFMPEAUYBSBND-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|