C19H24N2O4S — CID 158428043
O-(pyridin-3-ylmethyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanethioate (PubChem CID 158428043) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is O-(pyridin-3-ylmethyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanethioate.
| Compound Name | O-(pyridin-3-ylmethyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanethioate |
|---|---|
| PubChem CID | 158428043 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | O-(pyridin-3-ylmethyl) 5-(2,3-dioxopiperidin-4-yl)-4-oxo-3-propan-2-ylpentanethioate |
| SMILES | CC(C)C(CC(=S)OCc1cccnc1)C(=O)CC1CCNC(=O)C1=O |
| InChI | InChI=1S/C19H24N2O4S/c1-12(2)15(9-17(26)25-11-13-4-3-6-20-10-13)16(22)8-14-5-7-21-19(24)18(14)23/h3-4,6,10,12,14-15H,5,7-9,11H2,1-2H3,(H,21,24) |
| InChIKey | HBHMCBFUHNRSCP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|