C25H36N2O6 — CID 149498576
benzyl N-[1-(5,6-dioxo-1-oxa-7-azacyclododec-4-yl)-5-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 149498576) has the molecular formula C25H36N2O6 and a molecular weight of 460.57 g/mol. Its IUPAC name is benzyl N-[1-(5,6-dioxo-1-oxa-7-azacyclododec-4-yl)-5-methyl-2-oxohexan-3-yl]carbamate.
| Compound Name | benzyl N-[1-(5,6-dioxo-1-oxa-7-azacyclododec-4-yl)-5-methyl-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 149498576 |
| Molecular Formula | C25H36N2O6 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | benzyl N-[1-(5,6-dioxo-1-oxa-7-azacyclododec-4-yl)-5-methyl-2-oxohexan-3-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)CC1CCOCCCCCNC(=O)C1=O |
| InChI | InChI=1S/C25H36N2O6/c1-18(2)15-21(27-25(31)33-17-19-9-5-3-6-10-19)22(28)16-20-11-14-32-13-8-4-7-12-26-24(30)23(20)29/h3,5-6,9-10,18,20-21H,4,7-8,11-17H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | ZGNSOWUUUQEEIH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|