C25H32N4O5 — CID 161223920
benzyl N-[1-(6,7-dioxo-1,5,12-triazabicyclo[8.2.1]trideca-10(13),11-dien-8-yl)-5-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 161223920) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is benzyl N-[1-(6,7-dioxo-1,5,12-triazabicyclo[8.2.1]trideca-10(13),11-dien-8-yl)-5-methyl-2-oxohexan-3-yl]carbamate.
| Compound Name | benzyl N-[1-(6,7-dioxo-1,5,12-triazabicyclo[8.2.1]trideca-10(13),11-dien-8-yl)-5-methyl-2-oxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 161223920 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | benzyl N-[1-(6,7-dioxo-1,5,12-triazabicyclo[8.2.1]trideca-10(13),11-dien-8-yl)-5-methyl-2-oxohexan-3-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)CC1Cc2cnn(c2)CCCNC(=O)C1=O |
| InChI | InChI=1S/C25H32N4O5/c1-17(2)11-21(28-25(33)34-16-18-7-4-3-5-8-18)22(30)13-20-12-19-14-27-29(15-19)10-6-9-26-24(32)23(20)31/h3-5,7-8,14-15,17,20-21H,6,9-13,16H2,1-2H3,(H,26,32)(H,28,33) |
| InChIKey | UXWKVQQUJKJAJZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|