C24H35N3O6 — CID 138730351
benzyl N-[1-[(6,7-dioxo-1-oxa-5-azacyclododec-8-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 138730351) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is benzyl N-[1-[(6,7-dioxo-1-oxa-5-azacyclododec-8-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(6,7-dioxo-1-oxa-5-azacyclododec-8-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730351 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | benzyl N-[1-[(6,7-dioxo-1-oxa-5-azacyclododec-8-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC1CCCCOCCCNC(=O)C1=O |
| InChI | InChI=1S/C24H35N3O6/c1-17(2)15-20(27-24(31)33-16-18-9-4-3-5-10-18)22(29)26-19-11-6-7-13-32-14-8-12-25-23(30)21(19)28/h3-5,9-10,17,19-20H,6-8,11-16H2,1-2H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | JZVGZYFQYBCRFF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|