C20H27N3O6 — CID 138730509
benzyl N-[1-[(3,4-dioxooxazocan-5-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 138730509) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is benzyl N-[1-[(3,4-dioxooxazocan-5-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[(3,4-dioxooxazocan-5-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 138730509 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | benzyl N-[1-[(3,4-dioxooxazocan-5-yl)amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)CC(NC(=O)OCc1ccccc1)C(=O)NC1CCCONC(=O)C1=O |
| InChI | InChI=1S/C20H27N3O6/c1-13(2)11-16(22-20(27)28-12-14-7-4-3-5-8-14)18(25)21-15-9-6-10-29-23-19(26)17(15)24/h3-5,7-8,13,15-16H,6,9-12H2,1-2H3,(H,21,25)(H,22,27)(H,23,26) |
| InChIKey | FHVFEEXYPINXAK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|