C17H22N4O5 — CID 138730316
N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[2-oxo-3-(1H-pyrrol-3-yl)propanoyl]amino]butanamide (PubChem CID 138730316) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[2-oxo-3-(1H-pyrrol-3-yl)propanoyl]amino]butanamide.
| Compound Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[2-oxo-3-(1H-pyrrol-3-yl)propanoyl]amino]butanamide |
|---|---|
| PubChem CID | 138730316 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[2-oxo-3-(1H-pyrrol-3-yl)propanoyl]amino]butanamide |
| SMILES | CC(C)C(NC(=O)C(=O)Cc1cc[nH]c1)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C17H22N4O5/c1-9(2)13(16(25)20-11-4-6-19-17(26)14(11)23)21-15(24)12(22)7-10-3-5-18-8-10/h3,5,8-9,11,13,18H,4,6-7H2,1-2H3,(H,19,26)(H,20,25)(H,21,24) |
| InChIKey | NXVLMEBMTPDHDQ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|