C17H24N4O4 — CID 138731157
N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[3-(1H-pyrrol-2-yl)propanoylamino]butanamide (PubChem CID 138731157) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[3-(1H-pyrrol-2-yl)propanoylamino]butanamide.
| Compound Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[3-(1H-pyrrol-2-yl)propanoylamino]butanamide |
|---|---|
| PubChem CID | 138731157 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[3-(1H-pyrrol-2-yl)propanoylamino]butanamide |
| SMILES | CC(C)C(NC(=O)CCc1ccc[nH]1)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C17H24N4O4/c1-10(2)14(21-13(22)6-5-11-4-3-8-18-11)16(24)20-12-7-9-19-17(25)15(12)23/h3-4,8,10,12,14,18H,5-7,9H2,1-2H3,(H,19,25)(H,20,24)(H,21,22) |
| InChIKey | JTHIJNBJQJNYJC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|