C19H21N3O4S — CID 138731723
N-[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-1-benzothiophene-3-carboxamide (PubChem CID 138731723) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 138731723 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)C(NC(=O)c1csc2ccccc12)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C19H21N3O4S/c1-10(2)15(18(25)21-13-7-8-20-19(26)16(13)23)22-17(24)12-9-27-14-6-4-3-5-11(12)14/h3-6,9-10,13,15H,7-8H2,1-2H3,(H,20,26)(H,21,25)(H,22,24) |
| InChIKey | RKUQFUQJTRDNCZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|