C20H24N4O5 — CID 138730517
2-(1-benzofuran-3-ylmethylcarbamoylamino)-N-(2,3-dioxopiperidin-4-yl)-3-methylbutanamide (PubChem CID 138730517) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-(1-benzofuran-3-ylmethylcarbamoylamino)-N-(2,3-dioxopiperidin-4-yl)-3-methylbutanamide.
| Compound Name | 2-(1-benzofuran-3-ylmethylcarbamoylamino)-N-(2,3-dioxopiperidin-4-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 138730517 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-(1-benzofuran-3-ylmethylcarbamoylamino)-N-(2,3-dioxopiperidin-4-yl)-3-methylbutanamide |
| SMILES | CC(C)C(NC(=O)NCc1coc2ccccc12)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C20H24N4O5/c1-11(2)16(18(26)23-14-7-8-21-19(27)17(14)25)24-20(28)22-9-12-10-29-15-6-4-3-5-13(12)15/h3-6,10-11,14,16H,7-9H2,1-2H3,(H,21,27)(H,23,26)(H2,22,24,28) |
| InChIKey | IUYREPXRJJNXKE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|