C19H23N3O5S — CID 138730780
S-benzyl 2-[[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethanethioate (PubChem CID 138730780) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is S-benzyl 2-[[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethanethioate.
| Compound Name | S-benzyl 2-[[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethanethioate |
|---|---|
| PubChem CID | 138730780 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | S-benzyl 2-[[1-[(2,3-dioxopiperidin-4-yl)amino]-3-methyl-1-oxobutan-2-yl]amino]-2-oxoethanethioate |
| SMILES | CC(C)C(NC(=O)C(=O)SCc1ccccc1)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C19H23N3O5S/c1-11(2)14(16(24)21-13-8-9-20-17(25)15(13)23)22-18(26)19(27)28-10-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10H2,1-2H3,(H,20,25)(H,21,24)(H,22,26) |
| InChIKey | DLCXOGRGBOPHOX-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|