C17H22N4O4 — CID 138730757
N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(2-pyridin-4-ylacetyl)amino]butanamide (PubChem CID 138730757) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(2-pyridin-4-ylacetyl)amino]butanamide.
| Compound Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(2-pyridin-4-ylacetyl)amino]butanamide |
|---|---|
| PubChem CID | 138730757 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[(2-pyridin-4-ylacetyl)amino]butanamide |
| SMILES | CC(C)C(NC(=O)Cc1ccncc1)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C17H22N4O4/c1-10(2)14(21-13(22)9-11-3-6-18-7-4-11)16(24)20-12-5-8-19-17(25)15(12)23/h3-4,6-7,10,12,14H,5,8-9H2,1-2H3,(H,19,25)(H,20,24)(H,21,22) |
| InChIKey | REZQRLGFMRGQND-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|