C16H27N3O5 — CID 130408101
[1-[(2,3-dioxo-azacycloundec-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 130408101) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is [1-[(2,3-dioxo-azacycloundec-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [1-[(2,3-dioxo-azacycloundec-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 130408101 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [1-[(2,3-dioxo-azacycloundec-4-yl)amino]-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)C(NC(=O)O)C(=O)NC1CCCCCCCNC(=O)C1=O |
| InChI | InChI=1S/C16H27N3O5/c1-10(2)12(19-16(23)24)14(21)18-11-8-6-4-3-5-7-9-17-15(22)13(11)20/h10-12,19H,3-9H2,1-2H3,(H,17,22)(H,18,21)(H,23,24) |
| InChIKey | SLDHLHYWAFBODN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|