C42H51N5O8 — CID 145367321
benzyl N-[3-methyl-1-[(1-methyl-2,3-dioxoazepan-4-yl)amino]-1-oxobutan-2-yl]carbamate;N-[(4S)-2,3-dioxoazecan-4-yl]-2-phenylbenzamide (PubChem CID 145367321) has the molecular formula C42H51N5O8 and a molecular weight of 753.90 g/mol. Its IUPAC name is benzyl N-[3-methyl-1-[(1-methyl-2,3-dioxoazepan-4-yl)amino]-1-oxobutan-2-yl]carbamate;N-[(4S)-2,3-dioxoazecan-4-yl]-2-phenylbenzamide.
| Compound Name | benzyl N-[3-methyl-1-[(1-methyl-2,3-dioxoazepan-4-yl)amino]-1-oxobutan-2-yl]carbamate;N-[(4S)-2,3-dioxoazecan-4-yl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 145367321 |
| Molecular Formula | C42H51N5O8 |
| Molecular Weight | 753.90 g/mol |
| Exact Mass | 753.37 |
| IUPAC Name | benzyl N-[3-methyl-1-[(1-methyl-2,3-dioxoazepan-4-yl)amino]-1-oxobutan-2-yl]carbamate;N-[(4S)-2,3-dioxoazecan-4-yl]-2-phenylbenzamide |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC1CCCN(C)C(=O)C1=O.O=C1NCCCCCC[C@H](NC(=O)c2ccccc2-c2ccccc2)C1=O |
| InChI | InChI=1S/C22H24N2O3.C20H27N3O5/c25-20-19(14-6-1-2-9-15-23-22(20)27)24-21(26)18-13-8-7-12-17(18)16-10-4-3-5-11-16;1-13(2)16(22-20(27)28-12-14-8-5-4-6-9-14)18(25)21-15-10-7-11-23(3)19(26)17(15)24/h3-5,7-8,10-13,19H,1-2,6,9,14-15H2,(H,23,27)(H,24,26);4-6,8-9,13,15-16H,7,10-12H2,1-3H3,(H,21,25)(H,22,27)/t19-;/m0./s1 |
| InChIKey | MNQLKFBRQWAXGJ-FYZYNONXSA-N |
| XLogP | 4.34 |
| TPSA | 180.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.90 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|