C17H23N3O4S — CID 138731150
N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-(3-thiophen-2-ylpropanoylamino)butanamide (PubChem CID 138731150) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-(3-thiophen-2-ylpropanoylamino)butanamide.
| Compound Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-(3-thiophen-2-ylpropanoylamino)butanamide |
|---|---|
| PubChem CID | 138731150 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-(3-thiophen-2-ylpropanoylamino)butanamide |
| SMILES | CC(C)C(NC(=O)CCc1cccs1)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C17H23N3O4S/c1-10(2)14(20-13(21)6-5-11-4-3-9-25-11)16(23)19-12-7-8-18-17(24)15(12)22/h3-4,9-10,12,14H,5-8H2,1-2H3,(H,18,24)(H,19,23)(H,20,21) |
| InChIKey | ZNJFEGYQGWWCME-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|