C13H17N5OS — CID 124841571
N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-3-thiophen-2-ylpropanamide (PubChem CID 124841571) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-3-thiophen-2-ylpropanamide.
| Compound Name | N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 124841571 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-[(1R)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-3-thiophen-2-ylpropanamide |
| SMILES | C[C@@H](NC(=O)CCc1cccs1)c1nnnn1C1CC1 |
| InChI | InChI=1S/C13H17N5OS/c1-9(13-15-16-17-18(13)10-4-5-10)14-12(19)7-6-11-3-2-8-20-11/h2-3,8-10H,4-7H2,1H3,(H,14,19)/t9-/m1/s1 |
| InChIKey | ASYJDLADMDLESL-SECBINFHSA-N |
| XLogP | 1.88 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |