About 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea
3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea (PubChem CID 124730383) has the molecular formula C13H24N6O
and a molecular weight of 280.38 g/mol. Its IUPAC name is 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea.
Molecular Properties
| Compound Name | 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea |
| PubChem CID | 124730383 |
| Molecular Formula | C13H24N6O |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea |
| SMILES | CCCN(CCC)C(=O)N[C@@H](C)c1nnnn1C1CC1 |
| InChI | InChI=1S/C13H24N6O/c1-4-8-18(9-5-2)13(20)14-10(3)12-15-16-17-19(12)11-6-7-11/h10-11H,4-9H2,1-3H3,(H,14,20)/t10-/m0/s1 |
| InChIKey | HMDLSMDOKNDULC-JTQLQIEISA-N |
| XLogP | 1.90 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea?
The IUPAC name of 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea (CID 124730383) is 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea.
What is the SMILES notation for 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea?
The canonical SMILES for 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea is CCCN(CCC)C(=O)N[C@@H](C)c1nnnn1C1CC1.
What is the InChIKey of 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea?
The InChIKey is HMDLSMDOKNDULC-JTQLQIEISA-N. The full InChI is InChI=1S/C13H24N6O/c1-4-8-18(9-5-2)13(20)14-10(3)12-15-16-17-19(12)11-6-7-11/h10-11H,4-9H2,1-3H3,(H,14,20)/t10-/m0/s1.
What are the key properties of 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea?
3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea has a molecular weight of 280.38 g/mol, XLogP of 1.90, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-(1-cyclopropyltetrazol-5-yl)ethyl]-1,1-dipropylurea is sourced from PubChem (CID 124730383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).