C17H21N5O4 — CID 138730794
N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[5-(1H-pyrrol-2-yl)-1,3-oxazol-2-yl]amino]butanamide (PubChem CID 138730794) has the molecular formula C17H21N5O4 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[5-(1H-pyrrol-2-yl)-1,3-oxazol-2-yl]amino]butanamide.
| Compound Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[5-(1H-pyrrol-2-yl)-1,3-oxazol-2-yl]amino]butanamide |
|---|---|
| PubChem CID | 138730794 |
| Molecular Formula | C17H21N5O4 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(2,3-dioxopiperidin-4-yl)-3-methyl-2-[[5-(1H-pyrrol-2-yl)-1,3-oxazol-2-yl]amino]butanamide |
| SMILES | CC(C)C(Nc1ncc(-c2ccc[nH]2)o1)C(=O)NC1CCNC(=O)C1=O |
| InChI | InChI=1S/C17H21N5O4/c1-9(2)13(15(24)21-11-5-7-19-16(25)14(11)23)22-17-20-8-12(26-17)10-4-3-6-18-10/h3-4,6,8-9,11,13,18H,5,7H2,1-2H3,(H,19,25)(H,20,22)(H,21,24) |
| InChIKey | HLNSLALYXYTHOG-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|