C18H21N7O5 — CID 138730934
benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(2H-tetrazol-5-yl)ethyl]carbamate (PubChem CID 138730934) has the molecular formula C18H21N7O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(2H-tetrazol-5-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(2H-tetrazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 138730934 |
| Molecular Formula | C18H21N7O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | benzyl N-[2-[(2,3-dioxoazocan-4-yl)amino]-2-oxo-1-(2H-tetrazol-5-yl)ethyl]carbamate |
| SMILES | O=C(NC(C(=O)NC1CCCCNC(=O)C1=O)c1nn[nH]n1)OCc1ccccc1 |
| InChI | InChI=1S/C18H21N7O5/c26-14-12(8-4-5-9-19-17(14)28)20-16(27)13(15-22-24-25-23-15)21-18(29)30-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2,(H,19,28)(H,20,27)(H,21,29)(H,22,23,24,25) |
| InChIKey | JYGSVIUZYMMJQT-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 168.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|