C21H25N3O5S — CID 138730202
N-(2,3-dioxoazocan-4-yl)-2-[[hydroxy(phenylmethoxy)methyl]amino]-2-thiophen-3-ylacetamide (PubChem CID 138730202) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-(2,3-dioxoazocan-4-yl)-2-[[hydroxy(phenylmethoxy)methyl]amino]-2-thiophen-3-ylacetamide.
| Compound Name | N-(2,3-dioxoazocan-4-yl)-2-[[hydroxy(phenylmethoxy)methyl]amino]-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 138730202 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-(2,3-dioxoazocan-4-yl)-2-[[hydroxy(phenylmethoxy)methyl]amino]-2-thiophen-3-ylacetamide |
| SMILES | O=C1NCCCCC(NC(=O)C(NC(O)OCc2ccccc2)c2ccsc2)C1=O |
| InChI | InChI=1S/C21H25N3O5S/c25-18-16(8-4-5-10-22-20(18)27)23-19(26)17(15-9-11-30-13-15)24-21(28)29-12-14-6-2-1-3-7-14/h1-3,6-7,9,11,13,16-17,21,24,28H,4-5,8,10,12H2,(H,22,27)(H,23,26) |
| InChIKey | AKGDEIJUQRPUPZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|