C17H18N6O5 — CID 138730905
benzyl N-[2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxo-1-(1H-1,2,4-triazol-5-yl)ethyl]carbamate (PubChem CID 138730905) has the molecular formula C17H18N6O5 and a molecular weight of 386.37 g/mol. Its IUPAC name is benzyl N-[2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxo-1-(1H-1,2,4-triazol-5-yl)ethyl]carbamate.
| Compound Name | benzyl N-[2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxo-1-(1H-1,2,4-triazol-5-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 138730905 |
| Molecular Formula | C17H18N6O5 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | benzyl N-[2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxo-1-(1H-1,2,4-triazol-5-yl)ethyl]carbamate |
| SMILES | O=C(NC(C(=O)NC1CCNC(=O)C1=O)c1ncn[nH]1)OCc1ccccc1 |
| InChI | InChI=1S/C17H18N6O5/c24-13-11(6-7-18-16(13)26)21-15(25)12(14-19-9-20-23-14)22-17(27)28-8-10-4-2-1-3-5-10/h1-5,9,11-12H,6-8H2,(H,18,26)(H,21,25)(H,22,27)(H,19,20,23) |
| InChIKey | DQNLZPLTDGRBLD-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 155.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|