C21H19F2N3O5 — CID 138730876
benzyl N-[1-(3,5-difluorophenyl)-2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxoethyl]carbamate (PubChem CID 138730876) has the molecular formula C21H19F2N3O5 and a molecular weight of 431.40 g/mol. Its IUPAC name is benzyl N-[1-(3,5-difluorophenyl)-2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[1-(3,5-difluorophenyl)-2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 138730876 |
| Molecular Formula | C21H19F2N3O5 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | benzyl N-[1-(3,5-difluorophenyl)-2-[(2,3-dioxopiperidin-4-yl)amino]-2-oxoethyl]carbamate |
| SMILES | O=C(NC(C(=O)NC1CCNC(=O)C1=O)c1cc(F)cc(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C21H19F2N3O5/c22-14-8-13(9-15(23)10-14)17(19(28)25-16-6-7-24-20(29)18(16)27)26-21(30)31-11-12-4-2-1-3-5-12/h1-5,8-10,16-17H,6-7,11H2,(H,24,29)(H,25,28)(H,26,30) |
| InChIKey | RRYRUFJAHKABRL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|