C21H17Cl2NO7 — CID 68595829
(3S)-7-(2,6-dichlorophenyl)-4,5,7-trioxo-3-(phenylmethoxycarbonylamino)heptanoic acid (PubChem CID 68595829) has the molecular formula C21H17Cl2NO7 and a molecular weight of 466.27 g/mol. Its IUPAC name is (3S)-7-(2,6-dichlorophenyl)-4,5,7-trioxo-3-(phenylmethoxycarbonylamino)heptanoic acid.
| Compound Name | (3S)-7-(2,6-dichlorophenyl)-4,5,7-trioxo-3-(phenylmethoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 68595829 |
| Molecular Formula | C21H17Cl2NO7 |
| Molecular Weight | 466.27 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | (3S)-7-(2,6-dichlorophenyl)-4,5,7-trioxo-3-(phenylmethoxycarbonylamino)heptanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)OCc1ccccc1)C(=O)C(=O)CC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H17Cl2NO7/c22-13-7-4-8-14(23)19(13)16(25)10-17(26)20(29)15(9-18(27)28)24-21(30)31-11-12-5-2-1-3-6-12/h1-8,15H,9-11H2,(H,24,30)(H,27,28)/t15-/m0/s1 |
| InChIKey | XGZOSAQPIXGTLF-HNNXBMFYSA-N |
| XLogP | 3.47 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|