C17H17NO4S — CID 101202267
prop-2-enyl (2R)-2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetate (PubChem CID 101202267) has the molecular formula C17H17NO4S and a molecular weight of 331.39 g/mol. Its IUPAC name is prop-2-enyl (2R)-2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetate.
| Compound Name | prop-2-enyl (2R)-2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 101202267 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | prop-2-enyl (2R)-2-(phenylmethoxycarbonylamino)-2-thiophen-3-ylacetate |
| SMILES | C=CCOC(=O)[C@H](NC(=O)OCc1ccccc1)c1ccsc1 |
| InChI | InChI=1S/C17H17NO4S/c1-2-9-21-16(19)15(14-8-10-23-12-14)18-17(20)22-11-13-6-4-3-5-7-13/h2-8,10,12,15H,1,9,11H2,(H,18,20)/t15-/m1/s1 |
| InChIKey | OIAUJPRXMHBTFE-OAHLLOKOSA-N |
| XLogP | 3.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|