C37H44F2N4O13 — CID 135364565
5,7-difluoro-3,9-bis[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,6,8-trioxoundecanedioic acid (PubChem CID 135364565) has the molecular formula C37H44F2N4O13 and a molecular weight of 790.77 g/mol. Its IUPAC name is 5,7-difluoro-3,9-bis[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,6,8-trioxoundecanedioic acid.
| Compound Name | 5,7-difluoro-3,9-bis[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,6,8-trioxoundecanedioic acid |
|---|---|
| PubChem CID | 135364565 |
| Molecular Formula | C37H44F2N4O13 |
| Molecular Weight | 790.77 g/mol |
| Exact Mass | 790.29 |
| IUPAC Name | 5,7-difluoro-3,9-bis[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-4,6,8-trioxoundecanedioic acid |
| SMILES | CC(C)C(NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)O)C(=O)C(F)C(=O)C(F)C(=O)C(CC(=O)O)NC(=O)C(NC(=O)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C37H44F2N4O13/c1-19(2)29(42-36(53)55-17-21-11-7-5-8-12-21)34(51)40-23(15-25(44)45)31(48)27(38)33(50)28(39)32(49)24(16-26(46)47)41-35(52)30(20(3)4)43-37(54)56-18-22-13-9-6-10-14-22/h5-14,19-20,23-24,27-30H,15-18H2,1-4H3,(H,40,51)(H,41,52)(H,42,53)(H,43,54)(H,44,45)(H,46,47) |
| InChIKey | BAPOWDXWNVQHAK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 260.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.77 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|