C24H28N2O8P+ — CID 10458787
[(3S)-4-carboxy-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-2-oxobutoxy]-oxo-phenylphosphanium (PubChem CID 10458787) has the molecular formula C24H28N2O8P+ and a molecular weight of 503.47 g/mol. Its IUPAC name is [(3S)-4-carboxy-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-2-oxobutoxy]-oxo-phenylphosphanium.
| Compound Name | [(3S)-4-carboxy-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-2-oxobutoxy]-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 10458787 |
| Molecular Formula | C24H28N2O8P+ |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | [(3S)-4-carboxy-3-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-2-oxobutoxy]-oxo-phenylphosphanium |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)CO[P+](=O)c1ccccc1 |
| InChI | InChI=1S/C24H27N2O8P/c1-16(2)22(26-24(31)33-14-17-9-5-3-6-10-17)23(30)25-19(13-21(28)29)20(27)15-34-35(32)18-11-7-4-8-12-18/h3-12,16,19,22H,13-15H2,1-2H3,(H2-,25,26,28,29,30,31)/p+1/t19-,22-/m0/s1 |
| InChIKey | PXTAAUSTTSGLOF-UGKGYDQZSA-O |
| XLogP | 2.55 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|