C15H20INO4 — CID 122513704
iodomethyl 4-methyl-3-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 122513704) has the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. Its IUPAC name is iodomethyl 4-methyl-3-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | iodomethyl 4-methyl-3-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 122513704 |
| Molecular Formula | C15H20INO4 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | iodomethyl 4-methyl-3-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | CC(C)C(CC(=O)OCI)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H20INO4/c1-11(2)13(8-14(18)21-10-16)17-15(19)20-9-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,17,19) |
| InChIKey | WKLQHUJPNAGNLK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|