C25H26O5S — CID 22829315
2-O-benzyl 3-O-methyl (1R,2R,3S,4S)-2-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 22829315) has the molecular formula C25H26O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-O-benzyl 3-O-methyl (1R,2R,3S,4S)-2-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | 2-O-benzyl 3-O-methyl (1R,2R,3S,4S)-2-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 22829315 |
| Molecular Formula | C25H26O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 2-O-benzyl 3-O-methyl (1R,2R,3S,4S)-2-[(R)-(4-methylphenyl)sulfinyl]bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H]2C=C[C@@H](CC2)[C@@]1(C(=O)OCc1ccccc1)[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H26O5S/c1-17-8-14-21(15-9-17)31(28)25(24(27)30-16-18-6-4-3-5-7-18)20-12-10-19(11-13-20)22(25)23(26)29-2/h3-10,12,14-15,19-20,22H,11,13,16H2,1-2H3/t19-,20+,22+,25-,31-/m1/s1 |
| InChIKey | GHZUVYUQIXGSPH-GZYFCWDASA-N |
| XLogP | 3.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|