C25H36N2O6S — CID 58741546
benzyl N-[3-[2-[2-[3-[(4-methylphenyl)sulfinylamino]propoxy]ethoxy]ethoxy]propyl]carbamate (PubChem CID 58741546) has the molecular formula C25H36N2O6S and a molecular weight of 492.64 g/mol. Its IUPAC name is benzyl N-[3-[2-[2-[3-[(4-methylphenyl)sulfinylamino]propoxy]ethoxy]ethoxy]propyl]carbamate.
| Compound Name | benzyl N-[3-[2-[2-[3-[(4-methylphenyl)sulfinylamino]propoxy]ethoxy]ethoxy]propyl]carbamate |
|---|---|
| PubChem CID | 58741546 |
| Molecular Formula | C25H36N2O6S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | benzyl N-[3-[2-[2-[3-[(4-methylphenyl)sulfinylamino]propoxy]ethoxy]ethoxy]propyl]carbamate |
| SMILES | Cc1ccc(S(=O)NCCCOCCOCCOCCCNC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H36N2O6S/c1-22-9-11-24(12-10-22)34(29)27-14-6-16-31-18-20-32-19-17-30-15-5-13-26-25(28)33-21-23-7-3-2-4-8-23/h2-4,7-12,27H,5-6,13-21H2,1H3,(H,26,28) |
| InChIKey | LFWWJKHBNQHFAB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|