C20H29NO6 — CID 167464478
ethyl (E)-4-[3-[3-(phenylmethoxycarbonylamino)propoxy]propoxy]but-2-enoate (PubChem CID 167464478) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is ethyl (E)-4-[3-[3-(phenylmethoxycarbonylamino)propoxy]propoxy]but-2-enoate.
| Compound Name | ethyl (E)-4-[3-[3-(phenylmethoxycarbonylamino)propoxy]propoxy]but-2-enoate |
|---|---|
| PubChem CID | 167464478 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | ethyl (E)-4-[3-[3-(phenylmethoxycarbonylamino)propoxy]propoxy]but-2-enoate |
| SMILES | CCOC(=O)/C=C/COCCCOCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H29NO6/c1-2-26-19(22)11-6-13-24-15-8-16-25-14-7-12-21-20(23)27-17-18-9-4-3-5-10-18/h3-6,9-11H,2,7-8,12-17H2,1H3,(H,21,23)/b11-6+ |
| InChIKey | HQELQXASRFIPDF-IZZDOVSWSA-N |
| XLogP | 2.85 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|