C22H33NO8 — CID 168818022
ethyl (E)-4-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]but-2-enoate (PubChem CID 168818022) has the molecular formula C22H33NO8 and a molecular weight of 439.51 g/mol. Its IUPAC name is ethyl (E)-4-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]but-2-enoate.
| Compound Name | ethyl (E)-4-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]but-2-enoate |
|---|---|
| PubChem CID | 168818022 |
| Molecular Formula | C22H33NO8 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | ethyl (E)-4-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]but-2-enoate |
| SMILES | CCOC(=O)/C=C/COCCOCCOCCOCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H33NO8/c1-2-30-21(24)9-6-11-26-13-15-28-17-18-29-16-14-27-12-10-23-22(25)31-19-20-7-4-3-5-8-20/h3-9H,2,10-19H2,1H3,(H,23,25)/b9-6+ |
| InChIKey | SUUKDYMROAYILY-RMKNXTFCSA-N |
| XLogP | 2.10 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|