C17H12Cl2O2 — CID 134937240
(1S,2S,3S,6R,7R,8R)-1,8-dichloropentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene-15,16-dione (PubChem CID 134937240) has the molecular formula C17H12Cl2O2 and a molecular weight of 319.19 g/mol. Its IUPAC name is (1S,2S,3S,6R,7R,8R)-1,8-dichloropentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene-15,16-dione.
| Compound Name | (1S,2S,3S,6R,7R,8R)-1,8-dichloropentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene-15,16-dione |
|---|---|
| PubChem CID | 134937240 |
| Molecular Formula | C17H12Cl2O2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | (1S,2S,3S,6R,7R,8R)-1,8-dichloropentacyclo[6.6.2.13,6.02,7.09,14]heptadeca-4,9,11,13-tetraene-15,16-dione |
| SMILES | O=C1C(=O)[C@]2(Cl)c3ccccc3[C@@]1(Cl)[C@@H]1[C@H]2[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C17H12Cl2O2/c18-16-10-3-1-2-4-11(10)17(19,15(21)14(16)20)13-9-6-5-8(7-9)12(13)16/h1-6,8-9,12-13H,7H2/t8-,9+,12+,13-,16-,17+ |
| InChIKey | VGZZRRKPYOCHEU-UYVIHRIZSA-N |
| XLogP | 3.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|