C27H20ClN3 — CID 129431318
(1R,2R,6R,7R)-4-(4-chlorophenyl)spiro[3,4-diazatricyclo[5.2.1.02,6]dec-8-ene-5,9'-fluorene]-3-carbonitrile (PubChem CID 129431318) has the molecular formula C27H20ClN3 and a molecular weight of 421.93 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-(4-chlorophenyl)spiro[3,4-diazatricyclo[5.2.1.02,6]dec-8-ene-5,9'-fluorene]-3-carbonitrile.
| Compound Name | (1R,2R,6R,7R)-4-(4-chlorophenyl)spiro[3,4-diazatricyclo[5.2.1.02,6]dec-8-ene-5,9'-fluorene]-3-carbonitrile |
|---|---|
| PubChem CID | 129431318 |
| Molecular Formula | C27H20ClN3 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (1R,2R,6R,7R)-4-(4-chlorophenyl)spiro[3,4-diazatricyclo[5.2.1.02,6]dec-8-ene-5,9'-fluorene]-3-carbonitrile |
| SMILES | N#CN1[C@H]2[C@@H]([C@H]3C=C[C@H]2C3)C2(c3ccccc3-c3ccccc32)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20ClN3/c28-19-11-13-20(14-12-19)31-27(25-17-9-10-18(15-17)26(25)30(31)16-29)23-7-3-1-5-21(23)22-6-2-4-8-24(22)27/h1-14,17-18,25-26H,15H2/t17-,18-,25+,26+/m0/s1 |
| InChIKey | FQDVLXBFGUPUBO-PWAJYCBGSA-N |
| XLogP | 5.97 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|