C24H16ClN3O2 — CID 1202715
methyl 2'-(4-chlorophenyl)-1'-cyanospiro[fluorene-9,3'-pyrazole]-4'-carboxylate (PubChem CID 1202715) has the molecular formula C24H16ClN3O2 and a molecular weight of 413.86 g/mol. Its IUPAC name is methyl 2'-(4-chlorophenyl)-1'-cyanospiro[fluorene-9,3'-pyrazole]-4'-carboxylate.
| Compound Name | methyl 2'-(4-chlorophenyl)-1'-cyanospiro[fluorene-9,3'-pyrazole]-4'-carboxylate |
|---|---|
| PubChem CID | 1202715 |
| Molecular Formula | C24H16ClN3O2 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | methyl 2'-(4-chlorophenyl)-1'-cyanospiro[fluorene-9,3'-pyrazole]-4'-carboxylate |
| SMILES | COC(=O)C1=CN(C#N)N(c2ccc(Cl)cc2)C12c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C24H16ClN3O2/c1-30-23(29)22-14-27(15-26)28(17-12-10-16(25)11-13-17)24(22)20-8-4-2-6-18(20)19-7-3-5-9-21(19)24/h2-14H,1H3 |
| InChIKey | QHFXAWPIWRFFQJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|