C26H24ClN3 — CID 6566221
(5'S)-5'-butyl-2'-(4-chlorophenyl)spiro[fluorene-9,3'-pyrazolidine]-1'-carbonitrile (PubChem CID 6566221) has the molecular formula C26H24ClN3 and a molecular weight of 413.95 g/mol. Its IUPAC name is (5'S)-5'-butyl-2'-(4-chlorophenyl)spiro[fluorene-9,3'-pyrazolidine]-1'-carbonitrile.
| Compound Name | (5'S)-5'-butyl-2'-(4-chlorophenyl)spiro[fluorene-9,3'-pyrazolidine]-1'-carbonitrile |
|---|---|
| PubChem CID | 6566221 |
| Molecular Formula | C26H24ClN3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (5'S)-5'-butyl-2'-(4-chlorophenyl)spiro[fluorene-9,3'-pyrazolidine]-1'-carbonitrile |
| SMILES | CCCC[C@H]1CC2(c3ccccc3-c3ccccc32)N(c2ccc(Cl)cc2)N1C#N |
| InChI | InChI=1S/C26H24ClN3/c1-2-3-8-21-17-26(30(29(21)18-28)20-15-13-19(27)14-16-20)24-11-6-4-9-22(24)23-10-5-7-12-25(23)26/h4-7,9-16,21H,2-3,8,17H2,1H3/t21-/m0/s1 |
| InChIKey | VQBWTFRASAFFQA-NRFANRHFSA-N |
| XLogP | 6.73 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|