C29H26O2 — CID 177416314
(2R,3R,6S,7S,9R,10R,13S,14S)-1,8-diphenyl-15-oxahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadeca-4,11-dien-16-one (PubChem CID 177416314) has the molecular formula C29H26O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2R,3R,6S,7S,9R,10R,13S,14S)-1,8-diphenyl-15-oxahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadeca-4,11-dien-16-one.
| Compound Name | (2R,3R,6S,7S,9R,10R,13S,14S)-1,8-diphenyl-15-oxahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadeca-4,11-dien-16-one |
|---|---|
| PubChem CID | 177416314 |
| Molecular Formula | C29H26O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (2R,3R,6S,7S,9R,10R,13S,14S)-1,8-diphenyl-15-oxahexacyclo[6.6.2.13,6.110,13.02,7.09,14]octadeca-4,11-dien-16-one |
| SMILES | O=C1OC2(c3ccccc3)[C@@H]3[C@@H]([C@H]4C=C[C@@H]3C4)C1(c1ccccc1)[C@@H]1[C@H]2[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C29H26O2/c30-27-28(21-7-3-1-4-8-21)23-17-11-13-19(15-17)25(23)29(31-27,22-9-5-2-6-10-22)26-20-14-12-18(16-20)24(26)28/h1-14,17-20,23-26H,15-16H2/t17-,18+,19+,20-,23+,24-,25-,26+,28?,29? |
| InChIKey | OATMJIDWGKGQSK-OCMWTDNWSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|