C25H26O2 — CID 101200453
5-methoxy-4-(3-phenyl-3-tricyclo[3.2.1.02,4]octanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 101200453) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is 5-methoxy-4-(3-phenyl-3-tricyclo[3.2.1.02,4]octanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | 5-methoxy-4-(3-phenyl-3-tricyclo[3.2.1.02,4]octanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 101200453 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 5-methoxy-4-(3-phenyl-3-tricyclo[3.2.1.02,4]octanyl)tricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | COC1=C(C2(c3ccccc3)C3C4CCC(C4)C32)C(=O)C2C3C=CC(C3)C12 |
| InChI | InChI=1S/C25H26O2/c1-27-24-19-14-8-7-13(11-14)18(19)23(26)22(24)25(17-5-3-2-4-6-17)20-15-9-10-16(12-15)21(20)25/h2-8,13-16,18-21H,9-12H2,1H3 |
| InChIKey | OTYXJTAWTFDCCG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|