C16H21O3P — CID 98524405
(1R,2R,4R,5R)-3-dimethoxyphosphoryl-3-phenyltricyclo[3.2.1.02,4]octane (PubChem CID 98524405) has the molecular formula C16H21O3P and a molecular weight of 292.31 g/mol. Its IUPAC name is (1R,2R,4R,5R)-3-dimethoxyphosphoryl-3-phenyltricyclo[3.2.1.02,4]octane.
| Compound Name | (1R,2R,4R,5R)-3-dimethoxyphosphoryl-3-phenyltricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 98524405 |
| Molecular Formula | C16H21O3P |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | (1R,2R,4R,5R)-3-dimethoxyphosphoryl-3-phenyltricyclo[3.2.1.02,4]octane |
| SMILES | COP(=O)(OC)C1(c2ccccc2)[C@@H]2[C@@H]3CC[C@H](C3)[C@H]21 |
| InChI | InChI=1S/C16H21O3P/c1-18-20(17,19-2)16(13-6-4-3-5-7-13)14-11-8-9-12(10-11)15(14)16/h3-7,11-12,14-15H,8-10H2,1-2H3/t11-,12-,14-,15-/m1/s1 |
| InChIKey | RTZCVGBLWXNREY-QHSBEEBCSA-N |
| XLogP | 4.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|