C23H20O2 — CID 132543669
(1R,2R,6S,7S)-5-(4-methoxyphenyl)-4-phenyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 132543669) has the molecular formula C23H20O2 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1R,2R,6S,7S)-5-(4-methoxyphenyl)-4-phenyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1R,2R,6S,7S)-5-(4-methoxyphenyl)-4-phenyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 132543669 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (1R,2R,6S,7S)-5-(4-methoxyphenyl)-4-phenyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | COc1ccc(C2=C(c3ccccc3)C(=O)[C@H]3[C@@H]2[C@@H]2C=C[C@H]3C2)cc1 |
| InChI | InChI=1S/C23H20O2/c1-25-18-11-9-15(10-12-18)19-20-16-7-8-17(13-16)22(20)23(24)21(19)14-5-3-2-4-6-14/h2-12,16-17,20,22H,13H2,1H3/t16-,17+,20-,22-/m1/s1 |
| InChIKey | NNWHAOSCJVVSFC-IMLKGASGSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|